Products 1160256-20-1

CAS 1160256-20-1 appears in our catalog under these names: 2-(4-Sec-butylphenyl)-8-chloroquinoline-4-carbonyl chloride, 95%, 2-(4-(sec-Butyl)phenyl)-8-chloroquinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(4-butan-2-ylphenyl)-8-chloroquinoline-4-carbonyl chloride (CAS 1160256-20-1) is a chemical compound with the molecular formula C20H17Cl2NO and a molecular weight of 358.3 g/mol. IUPAC name: 2-(4-butan-2-ylphenyl)-8-chloroquinoline-4-carbonyl chloride. InChIKey: ITWIHPFZOQCATQ-UHFFFAOYSA-N.

Identity
Molecular formulaC20H17Cl2NO
Molecular weight358.3 g/mol
IUPAC name2-(4-butan-2-ylphenyl)-8-chloroquinoline-4-carbonyl chloride
InChIKeyITWIHPFZOQCATQ-UHFFFAOYSA-N
SMILESCCC(C)C1=CC=C(C=C1)C2=NC3=C(C=CC=C3Cl)C(=C2)C(=O)Cl

Computed by PubChem (NCBI)