CAS 1160256-66-5 appears in our catalog under these names: 7-Chloro-2-(2,5-dichlorophenyl)-8-methylquinoline-4-carbonyl chloride, 95%, 7-Chloro-2-(2,5-dichlorophenyl)-8-methylquinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
7-chloro-2-(2,5-dichlorophenyl)-8-methylquinoline-4-carbonyl chloride (CAS 1160256-66-5) is a chemical compound with the molecular formula C17H9Cl4NO and a molecular weight of 385.1 g/mol. IUPAC name: 7-chloro-2-(2,5-dichlorophenyl)-8-methylquinoline-4-carbonyl chloride. InChIKey: ANHBKJMQVHQUIR-UHFFFAOYSA-N.
| Molecular formula | C17H9Cl4NO |
|---|---|
| Molecular weight | 385.1 g/mol |
| IUPAC name | 7-chloro-2-(2,5-dichlorophenyl)-8-methylquinoline-4-carbonyl chloride |
| InChIKey | ANHBKJMQVHQUIR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1N=C(C=C2C(=O)Cl)C3=C(C=CC(=C3)Cl)Cl)Cl |
Computed by PubChem (NCBI)