Products 1160261-22-2

CAS 1160261-22-2 is the registry number for 8-Ethyl-2-(4-methylphenyl)quinoline-4-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

8-ethyl-2-(4-methylphenyl)quinoline-4-carbonyl chloride (CAS 1160261-22-2) is a chemical compound with the molecular formula C19H16ClNO and a molecular weight of 309.8 g/mol. IUPAC name: 8-ethyl-2-(4-methylphenyl)quinoline-4-carbonyl chloride. InChIKey: COTOAIPOGDAYCE-UHFFFAOYSA-N.

Identity
Molecular formulaC19H16ClNO
Molecular weight309.8 g/mol
IUPAC name8-ethyl-2-(4-methylphenyl)quinoline-4-carbonyl chloride
InChIKeyCOTOAIPOGDAYCE-UHFFFAOYSA-N
SMILESCCC1=C2C(=CC=C1)C(=CC(=N2)C3=CC=C(C=C3)C)C(=O)Cl

Computed by PubChem (NCBI)