Products 1160261-52-8
CAS 1160261-52-8 appears in our catalog under these names: 2-(3-Ethoxyphenyl)-7,8-dimethylquinoline-4-carbonyl chloride, 95%, 2-(3-Ethoxyphenyl)-7,8-dimethylquinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(3-ethoxyphenyl)-7,8-dimethylquinoline-4-carbonyl chloride (CAS 1160261-52-8) is a chemical compound with the molecular formula C20H18ClNO2 and a molecular weight of 339.8 g/mol. IUPAC name: 2-(3-ethoxyphenyl)-7,8-dimethylquinoline-4-carbonyl chloride. InChIKey: PGRRDHUZQAAQDV-UHFFFAOYSA-N.
| Molecular formula | C20H18ClNO2 |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | 2-(3-ethoxyphenyl)-7,8-dimethylquinoline-4-carbonyl chloride |
| InChIKey | PGRRDHUZQAAQDV-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC(=C1)C2=NC3=C(C=CC(=C3C)C)C(=C2)C(=O)Cl |
Computed by PubChem (NCBI)