CAS 1160263-06-8 is the registry number for 6-Chloro-2-(2-thienyl)quinoline-4-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-chloro-2-thiophen-2-ylquinoline-4-carbonyl chloride (CAS 1160263-06-8) is a chemical compound with the molecular formula C14H7Cl2NOS and a molecular weight of 308.2 g/mol. IUPAC name: 6-chloro-2-thiophen-2-ylquinoline-4-carbonyl chloride. InChIKey: NLYIGYOCUWDUDQ-UHFFFAOYSA-N.
| Molecular formula | C14H7Cl2NOS |
|---|---|
| Molecular weight | 308.2 g/mol |
| IUPAC name | 6-chloro-2-thiophen-2-ylquinoline-4-carbonyl chloride |
| InChIKey | NLYIGYOCUWDUDQ-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NC3=C(C=C(C=C3)Cl)C(=C2)C(=O)Cl |
Computed by PubChem (NCBI)