Products 1160263-06-8

CAS 1160263-06-8 is the registry number for 6-Chloro-2-(2-thienyl)quinoline-4-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

6-chloro-2-thiophen-2-ylquinoline-4-carbonyl chloride (CAS 1160263-06-8) is a chemical compound with the molecular formula C14H7Cl2NOS and a molecular weight of 308.2 g/mol. IUPAC name: 6-chloro-2-thiophen-2-ylquinoline-4-carbonyl chloride. InChIKey: NLYIGYOCUWDUDQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H7Cl2NOS
Molecular weight308.2 g/mol
IUPAC name6-chloro-2-thiophen-2-ylquinoline-4-carbonyl chloride
InChIKeyNLYIGYOCUWDUDQ-UHFFFAOYSA-N
SMILESC1=CSC(=C1)C2=NC3=C(C=C(C=C3)Cl)C(=C2)C(=O)Cl

Computed by PubChem (NCBI)