Products 1160263-09-1
CAS 1160263-09-1 appears in our catalog under these names: 6-Chloro-2-(5-ethyl-2-thienyl)quinoline-4-carbonyl chloride, 95%, 6-Chloro-2-(5-ethylthiophen-2-yl)quinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
6-chloro-2-(5-ethylthiophen-2-yl)quinoline-4-carbonyl chloride (CAS 1160263-09-1) is a chemical compound with the molecular formula C16H11Cl2NOS and a molecular weight of 336.2 g/mol. IUPAC name: 6-chloro-2-(5-ethylthiophen-2-yl)quinoline-4-carbonyl chloride. InChIKey: DZGQCDIUZWCFJQ-UHFFFAOYSA-N.
| Molecular formula | C16H11Cl2NOS |
|---|---|
| Molecular weight | 336.2 g/mol |
| IUPAC name | 6-chloro-2-(5-ethylthiophen-2-yl)quinoline-4-carbonyl chloride |
| InChIKey | DZGQCDIUZWCFJQ-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(S1)C2=NC3=C(C=C(C=C3)Cl)C(=C2)C(=O)Cl |
Computed by PubChem (NCBI)