Products 1160264-78-7
CAS 1160264-78-7 appears in our catalog under these names: 2-(4-tert-Butylphenyl)quinoline-4-carbonyl chloride, 95%, 2-(4-(tert-Butyl)phenyl)quinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(4-tert-butylphenyl)quinoline-4-carbonyl chloride (CAS 1160264-78-7) is a chemical compound with the molecular formula C20H18ClNO and a molecular weight of 323.8 g/mol. IUPAC name: 2-(4-tert-butylphenyl)quinoline-4-carbonyl chloride. InChIKey: BOPIFAQPNKCIPO-UHFFFAOYSA-N.
| Molecular formula | C20H18ClNO |
|---|---|
| Molecular weight | 323.8 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)quinoline-4-carbonyl chloride |
| InChIKey | BOPIFAQPNKCIPO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)Cl |
Computed by PubChem (NCBI)