CAS 1160303-44-5 is the registry number for Emtricitabine Impurity 39. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-amino-5-fluoro-1-[(2R,3S,5S)-2-(hydroxymethyl)-3-oxo-1,3-oxathiolan-5-yl]pyrimidin-2-one (CAS 1160303-44-5) is a chemical compound with the molecular formula C8H10FN3O4S and a molecular weight of 263.25 g/mol. IUPAC name: 4-amino-5-fluoro-1-[(2R,3S,5S)-2-(hydroxymethyl)-3-oxo-1,3-oxathiolan-5-yl]pyrimidin-2-one. InChIKey: DMOMZPWPIDCLMB-CRRVBNTOSA-N.
| Molecular formula | C8H10FN3O4S |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | 4-amino-5-fluoro-1-[(2R,3S,5S)-2-(hydroxymethyl)-3-oxo-1,3-oxathiolan-5-yl]pyrimidin-2-one |
| InChIKey | DMOMZPWPIDCLMB-CRRVBNTOSA-N |
| SMILES | C1[C@H](O[C@H]([S@]1=O)CO)N2C=C(C(=NC2=O)N)F |
Computed by PubChem (NCBI)