Products 1160357-16-3
CAS 1160357-16-3 appears in our catalog under these names: N-(2-Hydroxyethyl)piperazine-d4 Dihydrochloride, 1-(2-Hydroxyethyl)piperazine-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, Get quote.
1,1,2,2-tetradeuterio-2-piperazin-1-ylethanol (CAS 1160357-16-3) is a chemical compound with the molecular formula C6H14N2O and a molecular weight of 134.21 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-piperazin-1-ylethanol. InChIKey: WFCSWCVEJLETKA-NZLXMSDQSA-N.
| Molecular formula | C6H14N2O |
|---|---|
| Molecular weight | 134.21 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-piperazin-1-ylethanol |
| InChIKey | WFCSWCVEJLETKA-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)N1CCNCC1 |
Computed by PubChem (NCBI)