CAS 116052-94-9 is the registry number for p-NO2-Bn-Cyclen. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[(4-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododecane (CAS 116052-94-9) is a chemical compound with the molecular formula C15H25N5O2 and a molecular weight of 307.39 g/mol. IUPAC name: (2S)-2-[(4-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododecane. InChIKey: OKWOSNVPILWYNU-AWEZNQCLSA-N.
| Molecular formula | C15H25N5O2 |
|---|---|
| Molecular weight | 307.39 g/mol |
| IUPAC name | (2S)-2-[(4-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododecane |
| InChIKey | OKWOSNVPILWYNU-AWEZNQCLSA-N |
| SMILES | C1CNCCN[C@H](CNCCN1)CC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)