CAS 1160556-63-7 appears in our catalog under these names: 2,6-Bis(dimethylamino)-2'-bromo-1,1'-biphenyl, 98%, 2,6-Bis(dimethylamino)-2'-bromo-1,1'-biphenyl, ≥96%(HPLC), ≥96%(HPLC). Offered by: AmBeed, Chemat. Available pack sizes: 1g, 250mg.
2-(2-bromophenyl)-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine (CAS 1160556-63-7) is a chemical compound with the molecular formula C16H19BrN2 and a molecular weight of 319.24 g/mol. IUPAC name: 2-(2-bromophenyl)-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine. InChIKey: XLVOBPSJQPPHPA-UHFFFAOYSA-N.
| Molecular formula | C16H19BrN2 |
|---|---|
| Molecular weight | 319.24 g/mol |
| IUPAC name | 2-(2-bromophenyl)-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine |
| InChIKey | XLVOBPSJQPPHPA-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C(=CC=C1)N(C)C)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)