CAS 1160573-97-6 is the registry number for 1,5-Dibromo-2,3-dichloro-4-iodobenzene. Offered by: TRC. Available pack sizes: 100mg, 1g.
1,5-dibromo-2,3-dichloro-4-iodobenzene (CAS 1160573-97-6) is a chemical compound with the molecular formula C6HBr2Cl2I and a molecular weight of 430.69 g/mol. IUPAC name: 1,5-dibromo-2,3-dichloro-4-iodobenzene. InChIKey: SAYVVDBWSTZHLT-UHFFFAOYSA-N.
| Molecular formula | C6HBr2Cl2I |
|---|---|
| Molecular weight | 430.69 g/mol |
| IUPAC name | 1,5-dibromo-2,3-dichloro-4-iodobenzene |
| InChIKey | SAYVVDBWSTZHLT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)I)Cl)Cl)Br |
Computed by PubChem (NCBI)