CAS 1160574-47-9 is the registry number for 2-Chloro-3-bromo-6-iodonitrobenzene, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
1-bromo-2-chloro-4-iodo-3-nitrobenzene (CAS 1160574-47-9) is a chemical compound with the molecular formula C6H2BrClINO2 and a molecular weight of 362.35 g/mol. IUPAC name: 1-bromo-2-chloro-4-iodo-3-nitrobenzene. InChIKey: XETSYSSPRVSLRK-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClINO2 |
|---|---|
| Molecular weight | 362.35 g/mol |
| IUPAC name | 1-bromo-2-chloro-4-iodo-3-nitrobenzene |
| InChIKey | XETSYSSPRVSLRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Br)Cl)[N+](=O)[O-])I |
Computed by PubChem (NCBI)