CAS 1160790-26-0 is the registry number for 2-(1H-Imidazol-1-yl)pyrimidine-5-boronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-imidazol-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 1160790-26-0) is a chemical compound with the molecular formula C13H17BN4O2 and a molecular weight of 272.11 g/mol. IUPAC name: 2-imidazol-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: BCWMEGZPVCVYPQ-UHFFFAOYSA-N.
| Molecular formula | C13H17BN4O2 |
|---|---|
| Molecular weight | 272.11 g/mol |
| IUPAC name | 2-imidazol-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | BCWMEGZPVCVYPQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)N3C=CN=C3 |
Computed by PubChem (NCBI)