CAS 1160968-13-7 is the registry number for Ethyl 2-fluoro-2-((1-phenyl-1H-tetrazol-5-yl)sulfonyl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-fluoro-2-(1-phenyltetrazol-5-yl)sulfonylacetate (CAS 1160968-13-7) is a chemical compound with the molecular formula C11H11FN4O4S and a molecular weight of 314.30 g/mol. IUPAC name: ethyl 2-fluoro-2-(1-phenyltetrazol-5-yl)sulfonylacetate. InChIKey: UEGZZIJQMOZOOA-UHFFFAOYSA-N.
| Molecular formula | C11H11FN4O4S |
|---|---|
| Molecular weight | 314.30 g/mol |
| IUPAC name | ethyl 2-fluoro-2-(1-phenyltetrazol-5-yl)sulfonylacetate |
| InChIKey | UEGZZIJQMOZOOA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(F)S(=O)(=O)C1=NN=NN1C2=CC=CC=C2 |
Computed by PubChem (NCBI)