CAS 1161000-19-6 appears in our catalog under these names: (7R,8As)-octahydropyrrolo[1,2-a]pyrazin-7-ol, 95%, (7R,8aS)-rel-Octahydropyrrolo(1,2-a)pyrazin-7-ol, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 10g, 5g, 1g.
(7R,8aS)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-7-ol (CAS 1161000-19-6) is a chemical compound with the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. IUPAC name: (7R,8aS)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-7-ol. InChIKey: VLVMRQREBYGIBY-NKWVEPMBSA-N.
| Molecular formula | C7H14N2O |
|---|---|
| Molecular weight | 142.20 g/mol |
| IUPAC name | (7R,8aS)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-7-ol |
| InChIKey | VLVMRQREBYGIBY-NKWVEPMBSA-N |
| SMILES | C1CN2C[C@@H](C[C@H]2CN1)O |
Computed by PubChem (NCBI)