Products 1161014-75-0
CAS 1161014-75-0 appears in our catalog under these names: Ibuprofen Ester Impurity (PEG400), Ibuprofen Impurity 33, Tetraethyleneglycol Bisibuprofen Ester, >95% (HPLC), Tetraethyleneglycol bisibuprofen ester. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 2,5g, 250mg, 5mg, 2mg, 10mg, 25mg, 50mg.
2-[2-[2-[2-[2-[4-(2-methylpropyl)phenyl]propanoyloxy]ethoxy]ethoxy]ethoxy]ethyl 2-[4-(2-methylpropyl)phenyl]propanoate (CAS 1161014-75-0) is a chemical compound with the molecular formula C34H50O7 and a molecular weight of 570.8 g/mol. IUPAC name: 2-[2-[2-[2-[2-[4-(2-methylpropyl)phenyl]propanoyloxy]ethoxy]ethoxy]ethoxy]ethyl 2-[4-(2-methylpropyl)phenyl]propanoate. InChIKey: ARAGFSUIHFAIRQ-UHFFFAOYSA-N.
| Molecular formula | C34H50O7 |
|---|---|
| Molecular weight | 570.8 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[4-(2-methylpropyl)phenyl]propanoyloxy]ethoxy]ethoxy]ethoxy]ethyl 2-[4-(2-methylpropyl)phenyl]propanoate |
| InChIKey | ARAGFSUIHFAIRQ-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C(C)C(=O)OCCOCCOCCOCCOC(=O)C(C)C2=CC=C(C=C2)CC(C)C |
Computed by PubChem (NCBI)