Products 1161070-49-0
CAS 1161070-49-0 appears in our catalog under these names: Trimethylamine-d9 N-Oxide, >95% (HPLC), Trimethylamine–d9 N–oxide, Trimethylamine N-oxide-d9, 99.76%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 1mg, 10 mg, 1 mg, 5 mg.
1,1,1-trideuterio-N,N-bis(trideuteriomethyl)methanamine oxide (CAS 1161070-49-0) is a chemical compound with the molecular formula C3H9NO and a molecular weight of 84.16 g/mol. IUPAC name: 1,1,1-trideuterio-N,N-bis(trideuteriomethyl)methanamine oxide. InChIKey: UYPYRKYUKCHHIB-GQALSZNTSA-N.
| Molecular formula | C3H9NO |
|---|---|
| Molecular weight | 84.16 g/mol |
| IUPAC name | 1,1,1-trideuterio-N,N-bis(trideuteriomethyl)methanamine oxide |
| InChIKey | UYPYRKYUKCHHIB-GQALSZNTSA-N |
| SMILES | [2H]C([2H])([2H])[N+](C([2H])([2H])[2H])(C([2H])([2H])[2H])[O-] |
Computed by PubChem (NCBI)
Synonyms:
N,N-Bis((~2~H_3_)methyl)(~2~H_3_)methanamine N-oxide, N,N-Bis[(~2~H_3_)methyl](~2~H_3_)methanamine N-oxide, Trimethylamine-d9 N-Oxide, Trimethylamine N-oxide-d9, N,N-Di(methyl-d3)methan-d3-amine N-Oxide, 1,1,1-trideuterio-N,N-bis(trideuteriomethyl)methanamine oxide, Trimethyl-d9-amine N-Oxide, tris(methyl-d3)amine oxide-d3, Trimethylamine-d9 N-Oxide, 98 atom % D, 98% (CP)