CAS 1161233-85-7 appears in our catalog under these names: BTZ043, >95% (HPLC), BTZ043/ 99.97% (existing batch purity), BTZ043, BTZ043 99%, BTZ 043, 99%, 99%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 10mg, 50mg, 5mg, 1mg, 25mg, 100mg, 500mg, 250mg.
2-[(3S)-3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one (CAS 1161233-85-7) is a chemical compound with the molecular formula C17H16F3N3O5S and a molecular weight of 431.4 g/mol. IUPAC name: 2-[(3S)-3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one. InChIKey: GTUIRORNXIOHQR-VIFPVBQESA-N.
| Molecular formula | C17H16F3N3O5S |
|---|---|
| Molecular weight | 431.4 g/mol |
| IUPAC name | 2-[(3S)-3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
| InChIKey | GTUIRORNXIOHQR-VIFPVBQESA-N |
| SMILES | C[C@H]1COC2(O1)CCN(CC2)C3=NC(=O)C4=C(S3)C(=CC(=C4)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)