CAS 116129-86-3 is the registry number for 1-Ethyl-(E)-2-Benzylidenesuccinate. Offered by: Chemat Brand. Available pack sizes: on request.
3-ethoxycarbonyl-4-phenylbut-3-enoate (CAS 116129-86-3) is a chemical compound with the molecular formula C13H13O4- and a molecular weight of 233.24 g/mol. IUPAC name: 3-ethoxycarbonyl-4-phenylbut-3-enoate. InChIKey: VEYDSHORJUTFLG-UHFFFAOYSA-M.
| Molecular formula | C13H13O4- |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | 3-ethoxycarbonyl-4-phenylbut-3-enoate |
| InChIKey | VEYDSHORJUTFLG-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C(=CC1=CC=CC=C1)CC(=O)[O-] |
Computed by PubChem (NCBI)