CAS 1161415-28-6 appears in our catalog under these names: NOTA–bis(tBu)ester, NOTA-bis(tBu)ester 97%, 2-(4,7-Bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)acetic acid, 98%, 98%, NOTA-bis(tBu)ester, 98.0%, 2-(4,7-Bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)acetic acid, 96%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 250mg, 1g, 5g.
2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7-triazonan-1-yl]acetic acid (CAS 1161415-28-6) is a chemical compound with the molecular formula C20H37N3O6 and a molecular weight of 415.5 g/mol. IUPAC name: 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7-triazonan-1-yl]acetic acid. InChIKey: UACSRZWSADEYPK-UHFFFAOYSA-N.
| Molecular formula | C20H37N3O6 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7-triazonan-1-yl]acetic acid |
| InChIKey | UACSRZWSADEYPK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CN1CCN(CCN(CC1)CC(=O)OC(C)(C)C)CC(=O)O |
Computed by PubChem (NCBI)