Products 1161443-73-7
CAS 1161443-73-7 appears in our catalog under these names: Mosapride Impurity G, Mosapride N-Oxide, Mosapride N-Oxide, >95% (HPLC), Mosapride N-Oxide, 96.70%. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 2,5mg, 5mg, 10 mg, 5 mg, 2.5 mg.
4-amino-5-chloro-2-ethoxy-N-[[4-[(4-fluorophenyl)methyl]-4-oxidomorpholin-4-ium-2-yl]methyl]benzamide (CAS 1161443-73-7) is a chemical compound with the molecular formula C21H25ClFN3O4 and a molecular weight of 437.9 g/mol. IUPAC name: 4-amino-5-chloro-2-ethoxy-N-[[4-[(4-fluorophenyl)methyl]-4-oxidomorpholin-4-ium-2-yl]methyl]benzamide. InChIKey: IMJYXYWPAQJNFA-UHFFFAOYSA-N.
| Molecular formula | C21H25ClFN3O4 |
|---|---|
| Molecular weight | 437.9 g/mol |
| IUPAC name | 4-amino-5-chloro-2-ethoxy-N-[[4-[(4-fluorophenyl)methyl]-4-oxidomorpholin-4-ium-2-yl]methyl]benzamide |
| InChIKey | IMJYXYWPAQJNFA-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1C(=O)NCC2C[N+](CCO2)(CC3=CC=C(C=C3)F)[O-])Cl)N |
Computed by PubChem (NCBI)