Products 1161720-79-1
CAS 1161720-79-1 is the registry number for tert-Butyl N-(1-(Dimethylcarbamoyl)ethyl)carbamate. Offered by: TRC. Available pack sizes: 100mg.
Tert-butyl N-[1-(dimethylamino)-1-oxopropan-2-yl]carbamate (CAS 1161720-79-1) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl N-[1-(dimethylamino)-1-oxopropan-2-yl]carbamate. InChIKey: QBUSAFMZJRRELW-UHFFFAOYSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl N-[1-(dimethylamino)-1-oxopropan-2-yl]carbamate |
| InChIKey | QBUSAFMZJRRELW-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)