CAS 1161738-28-8 is the registry number for Safinamide Impurity U. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[[4-[(3-fluorophenyl)methoxy]-3-[(3-fluorophenyl)methyl]phenyl]methylamino]propanamide (CAS 1161738-28-8) is a chemical compound with the molecular formula C24H24F2N2O2 and a molecular weight of 410.5 g/mol. IUPAC name: (2R)-2-[[4-[(3-fluorophenyl)methoxy]-3-[(3-fluorophenyl)methyl]phenyl]methylamino]propanamide. InChIKey: UMTZZFVIHQNLBC-MRXNPFEDSA-N.
| Molecular formula | C24H24F2N2O2 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | (2R)-2-[[4-[(3-fluorophenyl)methoxy]-3-[(3-fluorophenyl)methyl]phenyl]methylamino]propanamide |
| InChIKey | UMTZZFVIHQNLBC-MRXNPFEDSA-N |
| SMILES | C[C@H](C(=O)N)NCC1=CC(=C(C=C1)OCC2=CC(=CC=C2)F)CC3=CC(=CC=C3)F |
Computed by PubChem (NCBI)