CAS 1161847-36-4 appears in our catalog under these names: 6-Chloroimidazo[1,2-b]pyridazin-8-amine, 95%, 6–Chloroimidazo(1,2–b)pyridazin–8–amine, 6-Chloro-imidazo(1,2-b)pyridazin-8-amine, 6-Chloroimidazo[1,2-b]pyridazin-8-amine 95%, 6-Chloroimidazo[1,2-b]pyridazin-8-amine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 5g, 250mg, 50mg.
6-chloroimidazo[1,2-b]pyridazin-8-amine (CAS 1161847-36-4) is a chemical compound with the molecular formula C6H5ClN4 and a molecular weight of 168.58 g/mol. IUPAC name: 6-chloroimidazo[1,2-b]pyridazin-8-amine. InChIKey: BTHAQNBCDQRTKN-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN4 |
|---|---|
| Molecular weight | 168.58 g/mol |
| IUPAC name | 6-chloroimidazo[1,2-b]pyridazin-8-amine |
| InChIKey | BTHAQNBCDQRTKN-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=N1)C(=CC(=N2)Cl)N |
Computed by PubChem (NCBI)