Products 116198-48-2
CAS 116198-48-2 is the registry number for A 53868A. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[[(2S)-1-[(2-aminoacetyl)amino]-4-methyl-1-oxopentan-2-yl]amino]prop-1-en-2-ylphosphonic acid (CAS 116198-48-2) is a chemical compound with the molecular formula C11H22N3O5P and a molecular weight of 307.28 g/mol. IUPAC name: 3-[[(2S)-1-[(2-aminoacetyl)amino]-4-methyl-1-oxopentan-2-yl]amino]prop-1-en-2-ylphosphonic acid. InChIKey: RKNQDNOCTQXFIH-VIFPVBQESA-N.
| Molecular formula | C11H22N3O5P |
|---|---|
| Molecular weight | 307.28 g/mol |
| IUPAC name | 3-[[(2S)-1-[(2-aminoacetyl)amino]-4-methyl-1-oxopentan-2-yl]amino]prop-1-en-2-ylphosphonic acid |
| InChIKey | RKNQDNOCTQXFIH-VIFPVBQESA-N |
| SMILES | CC(C)C[C@@H](C(=O)NC(=O)CN)NCC(=C)P(=O)(O)O |
Computed by PubChem (NCBI)