CAS 116222-56-1 is the registry number for Hesperetin Benzyl Ether. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-phenylmethoxy-2,3-dihydrochromen-4-one (CAS 116222-56-1) is a chemical compound with the molecular formula C23H20O6 and a molecular weight of 392.4 g/mol. IUPAC name: 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-phenylmethoxy-2,3-dihydrochromen-4-one. InChIKey: CDVCUUPVBSIPQT-UHFFFAOYSA-N.
| Molecular formula | C23H20O6 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-phenylmethoxy-2,3-dihydrochromen-4-one |
| InChIKey | CDVCUUPVBSIPQT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2CC(=O)C3=C(C=C(C=C3O2)OCC4=CC=CC=C4)O)O |
Computed by PubChem (NCBI)