CAS 1162257-02-4 appears in our catalog under these names: 4-(4-Ethynylbenzenesulfonyl)-piperazine-1-carboxylic acid tert-butyl ester, 97%, 4-(4-Ethynylbenzenesulfonyl)-piperazine-1-carboxylic acid tert-butyl ester, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl 4-(4-ethynylphenyl)sulfonylpiperazine-1-carboxylate (CAS 1162257-02-4) is a chemical compound with the molecular formula C17H22N2O4S and a molecular weight of 350.4 g/mol. IUPAC name: tert-butyl 4-(4-ethynylphenyl)sulfonylpiperazine-1-carboxylate. InChIKey: LSSTVRBCIGMSMU-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O4S |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | tert-butyl 4-(4-ethynylphenyl)sulfonylpiperazine-1-carboxylate |
| InChIKey | LSSTVRBCIGMSMU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)C#C |
Computed by PubChem (NCBI)