CAS 1162262-38-5 appears in our catalog under these names: 1,3,5-Trimethyl-1h-pyrazole-4-boronic acid hydrochloride, 95%, (1,3,5-Trimethyl-1H-pyrazol-4-yl)boronic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
(1,3,5-trimethylpyrazol-4-yl)boronic acid;hydrochloride (CAS 1162262-38-5) is a chemical compound with the molecular formula C6H12BClN2O2 and a molecular weight of 190.44 g/mol. IUPAC name: (1,3,5-trimethylpyrazol-4-yl)boronic acid;hydrochloride. InChIKey: HBVXRUDSVOJNOQ-UHFFFAOYSA-N.
| Molecular formula | C6H12BClN2O2 |
|---|---|
| Molecular weight | 190.44 g/mol |
| IUPAC name | (1,3,5-trimethylpyrazol-4-yl)boronic acid;hydrochloride |
| InChIKey | HBVXRUDSVOJNOQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(N(N=C1C)C)C)(O)O.Cl |
Computed by PubChem (NCBI)