CAS 1162333-97-2 is the registry number for (R)-4-Bromo-N-(1-morpholinopropan-2-yl)-2-nitroaniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-N-[(2R)-1-morpholin-4-ylpropan-2-yl]-2-nitroaniline (CAS 1162333-97-2) is a chemical compound with the molecular formula C13H18BrN3O3 and a molecular weight of 344.20 g/mol. IUPAC name: 4-bromo-N-[(2R)-1-morpholin-4-ylpropan-2-yl]-2-nitroaniline. InChIKey: NMKDWYNMMHMSHC-SNVBAGLBSA-N.
| Molecular formula | C13H18BrN3O3 |
|---|---|
| Molecular weight | 344.20 g/mol |
| IUPAC name | 4-bromo-N-[(2R)-1-morpholin-4-ylpropan-2-yl]-2-nitroaniline |
| InChIKey | NMKDWYNMMHMSHC-SNVBAGLBSA-N |
| SMILES | C[C@H](CN1CCOCC1)NC2=C(C=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)