CAS 116261-43-9 is the registry number for (S)-Benzyl piperidine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Benzyl (2S)-piperidine-2-carboxylate (CAS 116261-43-9) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: benzyl (2S)-piperidine-2-carboxylate. InChIKey: RSEPHCRIRACQML-LBPRGKRZSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | benzyl (2S)-piperidine-2-carboxylate |
| InChIKey | RSEPHCRIRACQML-LBPRGKRZSA-N |
| SMILES | C1CCN[C@@H](C1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)