CAS 1162697-04-2 appears in our catalog under these names: 5-Bromo-1-n-cyclohexylbenzene-1,2-diamine, 95%, 5-Bromo-N1-cyclohexylbenzene-1,2-diamine, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg.
4-bromo-2-N-cyclohexylbenzene-1,2-diamine (CAS 1162697-04-2) is a chemical compound with the molecular formula C12H17BrN2 and a molecular weight of 269.18 g/mol. IUPAC name: 4-bromo-2-N-cyclohexylbenzene-1,2-diamine. InChIKey: DPAABEDQHVXBTM-UHFFFAOYSA-N.
| Molecular formula | C12H17BrN2 |
|---|---|
| Molecular weight | 269.18 g/mol |
| IUPAC name | 4-bromo-2-N-cyclohexylbenzene-1,2-diamine |
| InChIKey | DPAABEDQHVXBTM-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC2=C(C=CC(=C2)Br)N |
Computed by PubChem (NCBI)