CAS 116277-82-8 appears in our catalog under these names: Sodium 1-chloroethane-1-sulfonate, 95%, Sodium 1-chloroethane-1-sulfonate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Sodium 1-chloroethanesulfonate (CAS 116277-82-8) is a chemical compound with the molecular formula C2H4ClNaO3S and a molecular weight of 166.56 g/mol. IUPAC name: sodium 1-chloroethanesulfonate. InChIKey: AKTHLFYZKHPYBY-UHFFFAOYSA-M.
| Molecular formula | C2H4ClNaO3S |
|---|---|
| Molecular weight | 166.56 g/mol |
| IUPAC name | sodium 1-chloroethanesulfonate |
| InChIKey | AKTHLFYZKHPYBY-UHFFFAOYSA-M |
| SMILES | CC(S(=O)(=O)[O-])Cl.[Na+] |
Computed by PubChem (NCBI)