Products 116295-83-1
CAS 116295-83-1 is the registry number for Coumarin-d6. Offered by: MedChemExpress. Available pack sizes: 1 mg.
3,4,5,6,7,8-hexadeuteriochromen-2-one (CAS 116295-83-1) is a chemical compound with the molecular formula C9H6O2 and a molecular weight of 152.18 g/mol. IUPAC name: 3,4,5,6,7,8-hexadeuteriochromen-2-one. InChIKey: ZYGHJZDHTFUPRJ-MZWXYZOWSA-N.
| Molecular formula | C9H6O2 |
|---|---|
| Molecular weight | 152.18 g/mol |
| IUPAC name | 3,4,5,6,7,8-hexadeuteriochromen-2-one |
| InChIKey | ZYGHJZDHTFUPRJ-MZWXYZOWSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=O)O2)[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)