CAS 1163136-19-3 is the registry number for 3-(3,5-Bis-trifluoromethyl-phenyl)-3-fluoro-butyramide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide (CAS 1163136-19-3) is a chemical compound with the molecular formula C12H10F7NO and a molecular weight of 317.20 g/mol. IUPAC name: 3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide. InChIKey: IMVOYHXEOPUATI-UHFFFAOYSA-N.
| Molecular formula | C12H10F7NO |
|---|---|
| Molecular weight | 317.20 g/mol |
| IUPAC name | 3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide |
| InChIKey | IMVOYHXEOPUATI-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)N)(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)F |
Computed by PubChem (NCBI)