Products 1163247-87-7
CAS 1163247-87-7 is the registry number for 4-(4-(tert-Butoxycarbonyl)piperazin-1-yl)-3-fluorobenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg.
3-fluoro-4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid (CAS 1163247-87-7) is a chemical compound with the molecular formula C16H21FN2O4 and a molecular weight of 324.35 g/mol. IUPAC name: 3-fluoro-4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid. InChIKey: IWLCZGWTYSNELA-UHFFFAOYSA-N.
| Molecular formula | C16H21FN2O4 |
|---|---|
| Molecular weight | 324.35 g/mol |
| IUPAC name | 3-fluoro-4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid |
| InChIKey | IWLCZGWTYSNELA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=C(C=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)