CAS 1163263-99-7 is the registry number for 4-Bromo-1,2,3,5-tetrahydro-6-methyl-s-indacene, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
4-bromo-6-methyl-1,2,3,5-tetrahydro-s-indacene (CAS 1163263-99-7) is a chemical compound with the molecular formula C13H13Br and a molecular weight of 249.15 g/mol. IUPAC name: 4-bromo-6-methyl-1,2,3,5-tetrahydro-s-indacene. InChIKey: QTOCQNXLZFODFR-UHFFFAOYSA-N.
| Molecular formula | C13H13Br |
|---|---|
| Molecular weight | 249.15 g/mol |
| IUPAC name | 4-bromo-6-methyl-1,2,3,5-tetrahydro-s-indacene |
| InChIKey | QTOCQNXLZFODFR-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C1)C(=C3CCCC3=C2)Br |
Computed by PubChem (NCBI)