Products 1163681-24-0
CAS 1163681-24-0 appears in our catalog under these names: 2-[3-(4-Methoxyphenyl)prop-2-enamido]propanoic acid, 95%, (3-(4-Methoxyphenyl)acryloyl)-L-alanine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoic acid (CAS 1163681-24-0) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoic acid. InChIKey: WUVZUPQRHXCIKE-VMPITWQZSA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoic acid |
| InChIKey | WUVZUPQRHXCIKE-VMPITWQZSA-N |
| SMILES | CC(C(=O)O)NC(=O)/C=C/C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)