CAS 116371-66-5 is the registry number for Gemcitabine diphosphate triethylamine salt. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (CAS 116371-66-5) is a chemical compound with the molecular formula C9H13F2N3O10P2 and a molecular weight of 423.16 g/mol. IUPAC name: [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate. InChIKey: FRQISCZGNNXEMD-QPPQHZFASA-N.
| Molecular formula | C9H13F2N3O10P2 |
|---|---|
| Molecular weight | 423.16 g/mol |
| IUPAC name | [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| InChIKey | FRQISCZGNNXEMD-QPPQHZFASA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2C([C@@H]([C@H](O2)COP(=O)(O)OP(=O)(O)O)O)(F)F |
Computed by PubChem (NCBI)