Products 116383-72-3
CAS 116383-72-3 is the registry number for 2,6-Bis(trifluoromethyl)nicotinic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2,6-bis(trifluoromethyl)pyridine-3-carboxylic acid (CAS 116383-72-3) is a chemical compound with the molecular formula C8H3F6NO2 and a molecular weight of 259.10 g/mol. IUPAC name: 2,6-bis(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: VHDLZWKUPOEICN-UHFFFAOYSA-N.
| Molecular formula | C8H3F6NO2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 2,6-bis(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | VHDLZWKUPOEICN-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)O)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)