CAS 116407-32-0 is the registry number for (1R,2R)-1,2-Diaminocyclohexane D-tartrate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2S,3S)-2,3-dihydroxybutanedioic acid;trans-(1R,2R)-cyclohexane-1,2-diamine (CAS 116407-32-0) is a chemical compound with the molecular formula C10H20N2O6 and a molecular weight of 264.28 g/mol. IUPAC name: (2S,3S)-2,3-dihydroxybutanedioic acid;trans-(1R,2R)-cyclohexane-1,2-diamine. InChIKey: GDOTUTAQOJUZOF-JWCLOVTGSA-N.
| Molecular formula | C10H20N2O6 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | (2S,3S)-2,3-dihydroxybutanedioic acid;trans-(1R,2R)-cyclohexane-1,2-diamine |
| InChIKey | GDOTUTAQOJUZOF-JWCLOVTGSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)N)N.[C@H]([C@@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)