Products 1164116-60-2

CAS 1164116-60-2 is the registry number for 1-((Chlorocarbonyl)oxy)ethyl isobutyrate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-carbonochloridoyloxyethyl 2-methylpropanoate (CAS 1164116-60-2) is a chemical compound with the molecular formula C7H11ClO4 and a molecular weight of 194.61 g/mol. IUPAC name: 1-carbonochloridoyloxyethyl 2-methylpropanoate. InChIKey: BALIJYGAQGNGDK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11ClO4
Molecular weight194.61 g/mol
IUPAC name1-carbonochloridoyloxyethyl 2-methylpropanoate
InChIKeyBALIJYGAQGNGDK-UHFFFAOYSA-N
SMILESCC(C)C(=O)OC(C)OC(=O)Cl

Computed by PubChem (NCBI)