CAS 116412-83-0 appears in our catalog under these names: 4–Chloro–3′,4′–dimethoxybenzophenone, (4-Chlorophenyl)(3,4-dimethoxyphenyl)methanone, 97%, 97%, 4-Chloro-3',4'-dimethoxybenzophenone, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
(4-chlorophenyl)-(3,4-dimethoxyphenyl)methanone (CAS 116412-83-0) is a chemical compound with the molecular formula C15H13ClO3 and a molecular weight of 276.71 g/mol. IUPAC name: (4-chlorophenyl)-(3,4-dimethoxyphenyl)methanone. InChIKey: MLLIIHAKTPXMFF-UHFFFAOYSA-N.
| Molecular formula | C15H13ClO3 |
|---|---|
| Molecular weight | 276.71 g/mol |
| IUPAC name | (4-chlorophenyl)-(3,4-dimethoxyphenyl)methanone |
| InChIKey | MLLIIHAKTPXMFF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C2=CC=C(C=C2)Cl)OC |
Computed by PubChem (NCBI)