CAS 1164153-22-3 appears in our catalog under these names: SR-3576, 98%, SR 3576, SR 3576, JNK3 Inhibitor XII, SR-3576, JNK3 Inhibitor XII, SR-3576 1PC X 5MG. Offered by: AmBeed, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 50mg, 250mg, 1mg, 5mg, 10mg, 25mg, 100mg, 1 mg.
3-[4-[(3-methylphenyl)carbamoylamino]pyrazol-1-yl]-N-(3,4,5-trimethoxyphenyl)benzamide (CAS 1164153-22-3) is a chemical compound with the molecular formula C27H27N5O5 and a molecular weight of 501.5 g/mol. IUPAC name: 3-[4-[(3-methylphenyl)carbamoylamino]pyrazol-1-yl]-N-(3,4,5-trimethoxyphenyl)benzamide. InChIKey: MTFAYLZZDJGFGV-UHFFFAOYSA-N.
| Molecular formula | C27H27N5O5 |
|---|---|
| Molecular weight | 501.5 g/mol |
| IUPAC name | 3-[4-[(3-methylphenyl)carbamoylamino]pyrazol-1-yl]-N-(3,4,5-trimethoxyphenyl)benzamide |
| InChIKey | MTFAYLZZDJGFGV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC(=O)NC2=CN(N=C2)C3=CC=CC(=C3)C(=O)NC4=CC(=C(C(=C4)OC)OC)OC |
Computed by PubChem (NCBI)