Products 1164153-25-6
CAS 1164153-25-6 is the registry number for SR-4326. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[4-[(2-chlorophenyl)carbamoylamino]pyrazol-1-yl]-N-(5-methyl-3-pyridinyl)benzamide (CAS 1164153-25-6) is a chemical compound with the molecular formula C23H19ClN6O2 and a molecular weight of 446.9 g/mol. IUPAC name: 3-[4-[(2-chlorophenyl)carbamoylamino]pyrazol-1-yl]-N-(5-methyl-3-pyridinyl)benzamide. InChIKey: KVVQUXAGSWSMKF-UHFFFAOYSA-N.
| Molecular formula | C23H19ClN6O2 |
|---|---|
| Molecular weight | 446.9 g/mol |
| IUPAC name | 3-[4-[(2-chlorophenyl)carbamoylamino]pyrazol-1-yl]-N-(5-methyl-3-pyridinyl)benzamide |
| InChIKey | KVVQUXAGSWSMKF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1)NC(=O)C2=CC(=CC=C2)N3C=C(C=N3)NC(=O)NC4=CC=CC=C4Cl |
Computed by PubChem (NCBI)
Synonyms:
Aminopyrazole inhibitor, 4326, orb1702772