CAS 116418-99-6 appears in our catalog under these names: Lansoprazole Impurity 35, 2-(Chloromethyl)-3-methyl-4-nitropyridine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(chloromethyl)-3-methyl-4-nitropyridine (CAS 116418-99-6) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: 2-(chloromethyl)-3-methyl-4-nitropyridine. InChIKey: JGITUYGRSZWVLB-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-(chloromethyl)-3-methyl-4-nitropyridine |
| InChIKey | JGITUYGRSZWVLB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CCl)[N+](=O)[O-] |
Computed by PubChem (NCBI)