Products 1164200-43-4
CAS 1164200-43-4 is the registry number for Tyrosinase-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione (CAS 1164200-43-4) is a chemical compound with the molecular formula C10H9N3O2S2 and a molecular weight of 267.3 g/mol. IUPAC name: 5-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione. InChIKey: RNSYZQZFZRNFIW-VZUCSPMQSA-N.
| Molecular formula | C10H9N3O2S2 |
|---|---|
| Molecular weight | 267.3 g/mol |
| IUPAC name | 5-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | RNSYZQZFZRNFIW-VZUCSPMQSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=N/C2=NNC(=S)S2)O |
Computed by PubChem (NCBI)