CAS 1164469-60-6 appears in our catalog under these names: Naftopidil hydrochloride, 98%, Naftopidil (hydrochloride), Naftopidil hydrochloride/ 99.95% (existing batch purity), Naftopidil hydrochloride, 1-(4-(2-Methoxyphenyl)piperazin-1-yl)-3-(naphthalen-1-yloxy)propan-2-ol hydrochloride, 98%, 98%. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 1g, 100mg, 25mg, 250mg, 50mg, 1mg, 2mg, 5mg.
1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-naphthalen-1-yloxypropan-2-ol;hydrochloride (CAS 1164469-60-6) is a chemical compound with the molecular formula C24H29ClN2O3 and a molecular weight of 428.9 g/mol. IUPAC name: 1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-naphthalen-1-yloxypropan-2-ol;hydrochloride. InChIKey: VQAAEWMEVIOHTJ-UHFFFAOYSA-N.
| Molecular formula | C24H29ClN2O3 |
|---|---|
| Molecular weight | 428.9 g/mol |
| IUPAC name | 1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-naphthalen-1-yloxypropan-2-ol;hydrochloride |
| InChIKey | VQAAEWMEVIOHTJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1N2CCN(CC2)CC(COC3=CC=CC4=CC=CC=C43)O.Cl |
Computed by PubChem (NCBI)