Products 1164478-67-4
CAS 1164478-67-4 is the registry number for SARS-CoV-2 3CLpro-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-(4-nitrophenyl)-2-oxoethyl] (Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoate (CAS 1164478-67-4) is a chemical compound with the molecular formula C24H17ClN2O6 and a molecular weight of 464.9 g/mol. IUPAC name: [2-(4-nitrophenyl)-2-oxoethyl] (Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoate. InChIKey: BFCXRRSXOTYUIA-STZFKDTASA-N.
| Molecular formula | C24H17ClN2O6 |
|---|---|
| Molecular weight | 464.9 g/mol |
| IUPAC name | [2-(4-nitrophenyl)-2-oxoethyl] (Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoate |
| InChIKey | BFCXRRSXOTYUIA-STZFKDTASA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N/C(=C\C2=CC=C(C=C2)Cl)/C(=O)OCC(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)