CAS 1164482-89-6 is the registry number for (2E,2'E)-4,4'-((Oxybis(4,1-phenylene))bis(azanediyl))bis(4-oxobut-2-enoic acid), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-4-[4-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenoxy]anilino]-4-oxobut-2-enoic acid (CAS 1164482-89-6) is a chemical compound with the molecular formula C20H16N2O7 and a molecular weight of 396.3 g/mol. IUPAC name: (E)-4-[4-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenoxy]anilino]-4-oxobut-2-enoic acid. InChIKey: YVWVFWWPASMBBP-WGDLNXRISA-N.
| Molecular formula | C20H16N2O7 |
|---|---|
| Molecular weight | 396.3 g/mol |
| IUPAC name | (E)-4-[4-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenoxy]anilino]-4-oxobut-2-enoic acid |
| InChIKey | YVWVFWWPASMBBP-WGDLNXRISA-N |
| SMILES | C1=CC(=CC=C1NC(=O)/C=C/C(=O)O)OC2=CC=C(C=C2)NC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)